2-(2,4,6-Trinitrophenyl)ethan-1-amine
 10247  C8H8N4O6  256.172
 InChI=1S/C8H8N4O6/c9-2-1-6-7(11(15)16)3-5(10(13)14)4-8(6)12(17)18/h3-4H,1-2,9H2
 LSFNTHOKEYNPLO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(cc(cc1N(=O)=O)N(=O)=O)N(=O)=O