1-(4,6-Difluoro-2H-1,3-benzodioxol-5-yl)-N-methylpropan-2-amine
 10221 C11H13F2NO2 229.223
 InChI=1S/C11H13F2NO2/c1-6(14-2)3-7-8(12)4-9-11(10(7)13)16-5-15-9/h4,6,14H,3,5H2,1-2H3
 ZZRPYZBRSMEKBQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1c(F)cc2c(c1F)OCO2)C