N-Acetyl-MDMA
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]-N-methylacetamide
 10214 C13H17NO3 235.279
 InChI=1S/C13H17NO3/c1-9(14(3)10(2)15)6-11-4-5-12-13(7-11)17-8-16-12/h4-5,7,9H,6,8H2,1-3H3
 YETLZLXFTJYZMU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C(=O)C)C)Cc1ccc2c(c1)OCO2