1-(1,3-Benzoxazol-6-yl)propan-2-amine
 10202 C10H12N2O 176.215
 InChI=1S/C10H12N2O/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5-7H,4,11H2,1H3
 FKBXPMJTMOLLLT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc2c(c1)ocn2)N