1-(1H-Benzimidazol-5-yl)propan-2-amine
 10200 C10H13N3 175.23
 InChI=1S/C10H13N3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5-7H,4,11H2,1H3,(H,12,13)
 InChI=1/C10H13N3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5-7H,4,11H2,1H3,(H,12,13)/f/h12H
 GHVYFIHTVCDPST-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc2c(c1)nc[nH]2)N