3C-BMH
3-(2H-1,3-Benzodioxol-5-yl)butan-2-amine
 10182 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-7(8(2)12)9-3-4-10-11(5-9)14-6-13-10/h3-5,7-8H,6,12H2,1-2H3
 HKXGJUYGZMJFTM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccc2c(c1)OCO2)C)N