Phenylpropanolmethylamine
2-(Methylamino)-1-phenylpropan-1-ol
 1018 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3
 KWGRBVOPPLSCSI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1)O)C