[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]hydrazine
 10173  C10H14N2O2  194.23
 InChI=1S/C10H14N2O2/c1-7(12-11)4-8-2-3-9-10(5-8)14-6-13-9/h2-3,5,7,12H,4,6,11H2,1H3
 ZTBPMPNPJPKIHB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1ccc2c(c1)OCO2)C