4-(2-Aminoethyl)-2-methylphenol
 10160 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-7-6-8(4-5-10)2-3-9(7)11/h2-3,6,11H,4-5,10H2,1H3
 XUUUAVMDYPPDOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)C)O