2-(4-Methoxy-3-methylphenyl)ethan-1-amine
 10158 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-8-7-9(5-6-11)3-4-10(8)12-2/h3-4,7H,5-6,11H2,1-2H3
 NBFFCNUWKJZAKU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)C)OC