4-(2-Aminoethyl)-2-fluorophenol
 10150  C8H10FNO  155.17
 InChI=1S/C8H10FNO/c9-7-5-6(3-4-10)1-2-8(7)11/h1-2,5,11H,3-4,10H2
 MBQWGRWJFUWYAA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)F)O