4-[2-(Propylamino)ethyl]benzene-1,2-diol
 10139 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-2-6-12-7-5-9-3-4-10(13)11(14)8-9/h3-4,8,12-14H,2,5-7H2,1H3
 WYIZELDTYZKNIL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNCCc1ccc(c(c1)O)O