3-(3,4-Dimethoxyphenyl)-1,1,1-trifluoropropan-2-amine
 10131 C11H14F3NO2 249.23
 InChI=1S/C11H14F3NO2/c1-16-8-4-3-7(5-9(8)17-2)6-10(15)11(12,13)14/h3-5,10H,6,15H2,1-2H3
 YTMKCDFDXDXMAT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(ccc1OC)CC(C(F)(F)F)N