[1-(3,4-Dimethoxyphenyl)propan-2-yl]hydrazine
 10130  C11H18N2O2  210.273
 InChI=1S/C11H18N2O2/c1-8(13-12)6-9-4-5-10(14-2)11(7-9)15-3/h4-5,7-8,13H,6,12H2,1-3H3
 HPKHFBFBFGSLPZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1ccc(c(c1)OC)OC)C