3-(2-Aminoethyl)-4-fluorophenol
 10114  C8H10FNO  155.17
 InChI=1S/C8H10FNO/c9-8-2-1-7(11)5-6(8)3-4-10/h1-2,5,11H,3-4,10H2
 SOLZMJPQOOYEMT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)ccc1F