3-(2-Aminoethyl)-4-sulfanylphenol
 10102  C8H11NOS  169.244
 InChI=1S/C8H11NOS/c9-4-3-6-5-7(10)1-2-8(6)11/h1-2,5,10-11H,3-4,9H2
 VLTBBYGBTUNWBJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)ccc1S