1-[2-Methoxy-5-(trifluoromethoxy)phenyl]propan-2-amine
 10087 C11H14F3NO2 249.23
 InChI=1S/C11H14F3NO2/c1-7(15)5-8-6-9(17-11(12,13)14)3-4-10(8)16-2/h3-4,6-7H,5,15H2,1-2H3
 PCGSYAQAAJIDPZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1CC(N)C)OC(F)(F)F