4-MeO-BzPip
(4-Methoxyphenyl)(piperidin-3-yl)methanone
 10083 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-16-12-6-4-10(5-7-12)13(15)11-3-2-8-14-9-11/h4-7,11,14H,2-3,8-9H2,1H3
 IVFUXVDIJXFSJM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)C(=O)C1CCCNC1