1-(2,5-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl)methanamine
 10076 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-13-9-3-4-10(14-2)11-7(6-12)5-8(9)11/h3-4,7H,5-6,12H2,1-2H3
 KOGYVUASEMCBJI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1CC2CN)OC