4-Ethoxy-2-methylamphetamine
1-(4-Ethoxy-2-methylphenyl)propan-2-amine
 10058 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-14-12-6-5-11(8-10(3)13)9(2)7-12/h5-7,10H,4,8,13H2,1-3H3
 JCOBOMAPGNPSSY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(c(c1)C)CC(N)C