2-Fluoro-4-trifluoromethylamphetamine
1-[2-Fluoro-4-(trifluoromethyl)phenyl]propan-2-amine
 10051  C10H11F4N  221.195
 InChI=1S/C10H11F4N/c1-6(15)4-7-2-3-8(5-9(7)11)10(12,13)14/h2-3,5-6H,4,15H2,1H3
 DVDNCVZWOIBEMF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1F)C(F)(F)F)N