5-Methoxy-2-{2-[(propan-2-yl)amino]ethyl}phenol
 10048 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-9(2)13-7-6-10-4-5-11(15-3)8-12(10)14/h4-5,8-9,13-14H,6-7H2,1-3H3
 MRUFXVPYAYMJKA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1)O)CCNC(C)C