2-[4-(3-Cyclopropylpropyl)-2-methoxyphenyl]ethan-1-amine
 10047 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-17-15-11-13(4-2-3-12-5-6-12)7-8-14(15)9-10-16/h7-8,11-12H,2-6,9-10,16H2,1H3
 CNYNXTWSHDTJGD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OC)CCCC1CC1