2-[3-Methoxy-2-(propan-2-yl)phenyl]ethan-1-amine
 10035 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(2)12-10(7-8-13)5-4-6-11(12)14-3/h4-6,9H,7-8,13H2,1-3H3
 IPMWSNYBFFSDEU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1C(C)C)OC