3-(2-Aminopropyl)benzene-1,2-diol
 10031 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-6(10)5-7-3-2-4-8(11)9(7)12/h2-4,6,11-12H,5,10H2,1H3
 LVEGUMBVRKKRQA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1O)O)N