2-(3-Methoxy-2-propoxyphenyl)ethan-1-amine
 10027 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-3-9-15-12-10(7-8-13)5-4-6-11(12)14-2/h4-6H,3,7-9,13H2,1-2H3
 VRXJEELFQIXTSM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1c(CCN)cccc1OC