N-[2-(2,3-Dimethoxyphenyl)ethyl]propan-2-amine
 10025 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-10(2)14-9-8-11-6-5-7-12(15-3)13(11)16-4/h5-7,10,14H,8-9H2,1-4H3
 GDCJQVOYOOAQNU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CCNC(C)C)cccc1OC