2,3,6-TCPEA
2-(2,3,6-Trichlorophenyl)ethan-1-amine
 10021  C8H8Cl3N  224.515
 InChI=1S/C8H8Cl3N/c9-6-1-2-7(10)8(11)5(6)3-4-12/h1-2H,3-4,12H2
 RCOKLVNTQNCYKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Cl)ccc(c1Cl)Cl