3-(3,5-Dimethoxyphenyl)-1,1,1-trifluoropropan-2-amine
 10014 C11H14F3NO2 249.23
 InChI=1S/C11H14F3NO2/c1-16-8-3-7(4-9(6-8)17-2)5-10(15)11(12,13)14/h3-4,6,10H,5,15H2,1-2H3
 YJFNSLJFDVSPIB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(C(F)(F)F)N)cc(c1)OC