2-[(3,5-Dichloro[1,1′-biphenyl]-2-yl)oxy]ethan-1-amine
 10012 C14H13Cl2NO 282.165
 InChI=1S/C14H13Cl2NO/c15-11-8-12(10-4-2-1-3-5-10)14(13(16)9-11)18-7-6-17/h1-5,8-9H,6-7,17H2
 VPBHLDHENUNWHJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCOc1c(Cl)cc(cc1c1ccccc1)Cl