2-[(3-Chloro[1,1′-biphenyl]-2-yl)oxy]ethan-1-amine
 10010 C14H14ClNO 247.72
 InChI=1S/C14H14ClNO/c15-13-8-4-7-12(14(13)17-10-9-16)11-5-2-1-3-6-11/h1-8H,9-10,16H2
 HVEPDWYPGZPHJG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCOc1c(Cl)cccc1c1ccccc1