Mexiletine
1-(2,6-Dimethylphenoxy)propan-2-amine
 10009 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3
 VLPIATFUUWWMKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(COc1c(C)cccc1C)N