2-(2,6-Dichlorophenoxy)cyclopropan-1-amine
 10008 C9H9Cl2NO 218.08
 InChI=1S/C9H9Cl2NO/c10-5-2-1-3-6(11)9(5)13-8-4-7(8)12/h1-3,7-8H,4,12H2
 AYILJJPQFZUDKH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1Oc1c(Cl)cccc1Cl