1-[(2,6-Dichlorophenyl)methyl]-N-methylcyclopropan-1-amine
 10006 C11H13Cl2N 230.134
 InChI=1S/C11H13Cl2N/c1-14-11(5-6-11)7-8-9(12)3-2-4-10(8)13/h2-4,14H,5-7H2,1H3
 VPLFXDNMUDWEGD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1(CC1)Cc1c(Cl)cccc1Cl