1-[(2,6-Dichlorophenyl)methyl]cyclopropan-1-amine
 10005 C10H11Cl2N 216.107
 InChI=1S/C10H11Cl2N/c11-8-2-1-3-9(12)7(8)6-10(13)4-5-10/h1-3H,4-6,13H2
 PPZCAMXBHXGMJD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1(CC1)Cc1c(Cl)cccc1Cl