2,5-DCA
1-(2,5-Dichlorophenyl)propan-2-amine
 10004 C9H11Cl2N 204.096
 InChI=1S/C9H11Cl2N/c1-6(12)4-7-5-8(10)2-3-9(7)11/h2-3,5-6H,4,12H2,1H3
 HTEBKXXBGSCPMS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(Cl)ccc1Cl)N