2,6-DFPEA
2-(2,6-Difluorophenyl)ethan-1-amine
 10003 C8H9F2N 157.161
 InChI=1S/C8H9F2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4-5,11H2
 ADHKZSNGELMMAG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(F)cccc1F