2-[2-Methoxy-6-(3-phenylpropyl)phenyl]ethan-1-amine
 10002 C18H23NO 269.381
 InChI=1S/C18H23NO/c1-20-18-12-6-11-16(17(18)13-14-19)10-5-9-15-7-3-2-4-8-15/h2-4,6-8,11-12H,5,9-10,13-14,19H2,1H3
 JVFUVCGVKRPDRZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(CCCc2ccccc2)cccc1OC