EA-1545
3,6,6,9-Tetramethyl-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 9963 C17H22O2 258.355
 InChI=1S/C17H22O2/c1-10-5-6-13-12(7-10)16-14(18)8-11(2)9-15(16)19-17(13,3)4/h8-10,18H,5-7H2,1-4H3
 WIVRCLNIDINBEF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1CCC2=C(C1)c1c(O)cc(cc1OC2(C)C)C