EA-1507
6,6,9-Trimethyl-3-pentyl-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1-yl dimethylcarbamate
 9960 C24H35NO3 385.54
 Cannabinoid
 InChI=1S/C24H35NO3/c1-7-8-9-10-17-14-20(27-23(26)25(5)6)22-18-13-16(2)11-12-19(18)24(3,4)28-21(22)15-17/h14-16H,7-13H2,1-6H3
 NHDBYJVNYIZITM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(OC(=O)N(C)C)c2c(c1)OC(C1=C2CC(C)CC1)(C)C