EA-1465
6,6,9-Trimethyl-3-(nonan-2-yl)-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 9959 C25H38O2 370.568
 Cannabinoid
 InChI=1S/C25H38O2/c1-6-7-8-9-10-11-18(3)19-15-22(26)24-20-14-17(2)12-13-21(20)25(4,5)27-23(24)16-19/h15-18,26H,6-14H2,1-5H3
 NBBNVTWUGVPAOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCCC(c1cc(O)c2c(c1)OC(C1=C2CC(C)CC1)(C)C)C