THC isomer 1,3
(6aR)-6,6,9-Trimethyl-1-pentyl-6a,7,8,10a-tetrahydro-6H-dibenzo[b,d]pyran-3-ol
 9953 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-15-12-16(22)13-19-20(15)17-11-14(2)9-10-18(17)21(3,4)23-19/h11-13,17-18,22H,5-10H2,1-4H3/t17?,18-/m1/s1
 SBDHCUZETSWOAX-QRWMCTBCSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)cc2c1C1C=C(C)CC[C@H]1C(O2)(C)C