Cannabidiorcol
(2′R)-4,5′-Dimethyl-2′-(prop-1-en-2-yl)-1′,2′,3′,4′-tetrahydro[1,1′-biphenyl]-2,6-diol
 9948 C17H22O2 258.355
 Cannabinoid
 InChI=1S/C17H22O2/c1-10(2)13-6-5-11(3)7-14(13)17-15(18)8-12(4)9-16(17)19/h7-9,13-14,18-19H,1,5-6H2,2-4H3/t13-,14?/m0/s1
 GKVOVXWEBSQJPA-LSLKUGRBSA-N This stereoisomer Any stereoisomer
 CC1=CC([C@@H](CC1)C(=C)C)c1c(O)cc(cc1O)C