Tetrahydrocannabiorcol
(6aR)-3,6,6,9-Tetramethyl-6a,7,8,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 9947 C17H22O2 258.355
 Cannabinoid
 InChI=1S/C17H22O2/c1-10-5-6-13-12(7-10)16-14(18)8-11(2)9-15(16)19-17(13,3)4/h7-9,12-13,18H,5-6H2,1-4H3/t12?,13-/m1/s1
 WIDIPARNVYRVNW-ZGTCLIOFSA-N This stereoisomer Any stereoisomer
 CC1=CC2[C@@H](CC1)C(C)(C)Oc1c2c(O)cc(c1)C