Cannabitriol ester of cannabidiolic acid
1,10-Dihydroxy-6,6,9-trimethyl-3-pentyl-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-9-yl (1′R,2′R)-2,6-dihydroxy-5′-methyl-4-pentyl-2′-(prop-1-en-2-yl)-1′,2′,3′,4′-tetrahydro[1,1′-biphenyl]-3-carboxylate
 9945 C43H58O7 686.916
 Cannabinoid
 InChI=1S/C43H58O7/c1-9-11-13-15-27-22-32(44)38-34(23-27)49-42(6,7)31-19-20-43(8,40(47)37(31)38)50-41(48)35-28(16-14-12-10-2)24-33(45)36(39(35)46)30-21-26(5)17-18-29(30)25(3)4/h21-24,29-30,40,44-47H,3,9-20H2,1-2,4-8H3/t29-,30+,40?,43?/m0/s1
 RZDRXTQWQOGFJG-GTNOGLKHSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC(C1=C2C(O)C(C)(CC1)OC(=O)c1c(CCCCC)cc(c(c1O)[C@@H]1C=C(C)CC[C@H]1C(=C)C)O)(C)C