PCsB
N-(Butan-2-yl)-1-phenylcyclohexan-1-amine
 993 C16H25N 231.376
 Arylcycloalkylamine
 InChI=1S/C16H25N/c1-3-14(2)17-16(12-8-5-9-13-16)15-10-6-4-7-11-15/h4,6-7,10-11,14,17H,3,5,8-9,12-13H2,1-2H3
 JJMSDQXTEPWGFE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(NC1(CCCCC1)c1ccccc1)C