N-Acetyl-3-TFMA
N-{1-[3-(Trifluoromethyl)phenyl]propan-2-yl}acetamide
 9857  C12H14F3NO  245.241
 InChI=1S/C12H14F3NO/c1-8(16-9(2)17)6-10-4-3-5-11(7-10)12(13,14)15/h3-5,7-8H,6H2,1-2H3,(H,16,17)
 ZVKARXLKNIBGIR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)C(F)(F)F)NC(=O)C