N-Methyl-N-propargyl-3-TFMA
N-Methyl-N-{1-[3-(trifluoromethyl)phenyl]propan-2-yl}prop-2-yn-1-amine
 9854  C14H16F3N  255.279
 InChI=1S/C14H16F3N/c1-4-8-18(3)11(2)9-12-6-5-7-13(10-12)14(15,16)17/h1,5-7,10-11H,8-9H2,2-3H3
 OYVVMAFOMSCBML-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#CCN(C(Cc1cccc(c1)C(F)(F)F)C)C