N,N-DM-homo-PEA
N,N-Dimethyl-3-phenylpropan-1-amine
 9772 C11H17N 163.259
 InChI=1S/C11H17N/c1-12(2)10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3
 NMXXDRKTOJAAQS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCCc1ccccc1)C