4-Carboxymethamphetamine-NBOH
4-(2-{[(2-Hydroxyphenyl)methyl](methyl)amino}propyl)benzoic acid
 9738  C18H21NO3  299.364
 InChI=1S/C18H21NO3/c1-13(11-14-7-9-15(10-8-14)18(21)22)19(2)12-16-5-3-4-6-17(16)20/h3-10,13,20H,11-12H2,1-2H3,(H,21,22)
 VGEWZFRBULYXMX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccc(cc1)C(=O)O)C)Cc1ccccc1O